CAS 955050-88-1 is the registry number for 5'–(2–Carboxyphenyl)–(1,1':3',1''–terphenyl)–2,2''–dicarboxylicacid. Offered by: GLPBio. Available pack sizes: 5g.
2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid (CAS 955050-88-1) is a chemical compound with the molecular formula C27H18O6 and a molecular weight of 438.4 g/mol. IUPAC name: 2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid. InChIKey: SVAJWMFPXLZPHL-UHFFFAOYSA-N.
| Molecular formula | C27H18O6 |
|---|---|
| Molecular weight | 438.4 g/mol |
| IUPAC name | 2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | SVAJWMFPXLZPHL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC(=C2)C3=CC=CC=C3C(=O)O)C4=CC=CC=C4C(=O)O)C(=O)O |
Computed by PubChem (NCBI)