Products 168560-79-0
CAS 168560-79-0 appears in our catalog under these names: AIDA, UPF-523, UPF-523, 99.0%, 99.0%, UPF-523, 99.89%. Offered by: TRC, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 250mg, 10mg, 50mg, 1mg, 5mg, 5 mg, 10 mg.
1-amino-2,3-dihydroindene-1,5-dicarboxylic acid (CAS 168560-79-0) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 1-amino-2,3-dihydroindene-1,5-dicarboxylic acid. InChIKey: LSTPKMWNRWCNLS-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 1-amino-2,3-dihydroindene-1,5-dicarboxylic acid |
| InChIKey | LSTPKMWNRWCNLS-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C1C=C(C=C2)C(=O)O)(C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
(RS)-aminoindan-1,5-dicarboxylic Acid, AIDA, 1-amino-2,3-dihydroindene-1,5-dicarboxylic acid, 1-Amino-2,3-dihydro-1H-indene-1,5-dicarboxylic acid, 1H-Indene-1,5-dicarboxylic acid, 1-amino-2,3-dihydro-, 1-Aminoindan-1,5-dicarboxylic acid, (RS)-1-Aminoindan-1,5-dicarboxylic acid, AIDA, solid, AIDC, Indan-1,5-dicarboxylic acid, 1-amino-