Products 1686134-45-1
CAS 1686134-45-1 is the registry number for 4-(2,6-dimethoxypyridin-3-yl)benzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
4-(2,6-dimethoxy-3-pyridinyl)benzaldehyde (CAS 1686134-45-1) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: 4-(2,6-dimethoxy-3-pyridinyl)benzaldehyde. InChIKey: AYRRCWHRXFWVJU-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 4-(2,6-dimethoxy-3-pyridinyl)benzaldehyde |
| InChIKey | AYRRCWHRXFWVJU-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)C2=CC=C(C=C2)C=O)OC |
Computed by PubChem (NCBI)