Products 168618-92-6

CAS 168618-92-6 is the registry number for Methyl 3'-chloro[1,1'-biphenyl]-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 3-(3-chlorophenyl)benzoate (CAS 168618-92-6) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: methyl 3-(3-chlorophenyl)benzoate. InChIKey: TVDSGDKYTGEAQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClO2
Molecular weight246.69 g/mol
IUPAC namemethyl 3-(3-chlorophenyl)benzoate
InChIKeyTVDSGDKYTGEAQJ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC(=C1)C2=CC(=CC=C2)Cl

Computed by PubChem (NCBI)