CAS 472810-33-6 is the registry number for methyl 2-chloro-4-phenylbenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 2-chloro-4-phenylbenzoate (CAS 472810-33-6) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: methyl 2-chloro-4-phenylbenzoate. InChIKey: DYTXGXKGEPJADU-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | methyl 2-chloro-4-phenylbenzoate |
| InChIKey | DYTXGXKGEPJADU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)