CAS 773134-21-7 is the registry number for Methyl 4'-chloro[1,1'-biphenyl]-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-(4-chlorophenyl)benzoate (CAS 773134-21-7) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: methyl 3-(4-chlorophenyl)benzoate. InChIKey: HUGWWAOXLBJUCT-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | methyl 3-(4-chlorophenyl)benzoate |
| InChIKey | HUGWWAOXLBJUCT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)