Products 16868-12-5

CAS 16868-12-5 is the registry number for 1,7,7-Trimethylbicyclo[2.2.1]heptan-2-yl methacrylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-methylprop-2-enoate (CAS 16868-12-5) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-methylprop-2-enoate. InChIKey: IAXXETNIOYFMLW-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22O2
Molecular weight222.32 g/mol
IUPAC name(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-methylprop-2-enoate
InChIKeyIAXXETNIOYFMLW-UHFFFAOYSA-N
SMILESCC(=C)C(=O)OC1CC2CCC1(C2(C)C)C

Computed by PubChem (NCBI)