CAS 7534-94-3 appears in our catalog under these names: Isobornyl methacrylate, Isobornyl Methacrylate (bio-based carbon from plant ca. 71%) (stabilized with MEHQ), >85.0%(GC), Isobornyl methacrylate, 85-90%, stabilized, Isobornyl Methacrylate (stabilized with MEHQ), >85.0%(GC), ISOBORNYL METHACRYLATE, TECH.. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Sigma-Aldrich, Chemat. Available pack sizes: 500g, 25g, 1KG, 250g, 100ML, 1L, 500ML, 10g.
[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate (CAS 7534-94-3) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate. InChIKey: IAXXETNIOYFMLW-GYSYKLTISA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
| InChIKey | IAXXETNIOYFMLW-GYSYKLTISA-N |
| SMILES | CC(=C)C(=O)O[C@@H]1C[C@H]2CC[C@@]1(C2(C)C)C |
Computed by PubChem (NCBI)