Products 168759-63-5

CAS 168759-63-5 is the registry number for 4-Bromo-2-((carboxymethoxy)methyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-bromo-2-(carboxymethoxymethyl)benzoic acid (CAS 168759-63-5) is a chemical compound with the molecular formula C10H9BrO5 and a molecular weight of 289.08 g/mol. IUPAC name: 4-bromo-2-(carboxymethoxymethyl)benzoic acid. InChIKey: FPBFQGFBLKPQOV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9BrO5
Molecular weight289.08 g/mol
IUPAC name4-bromo-2-(carboxymethoxymethyl)benzoic acid
InChIKeyFPBFQGFBLKPQOV-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Br)COCC(=O)O)C(=O)O

Computed by PubChem (NCBI)