CAS 20037-38-1 appears in our catalog under these names: (4-Bromo-2-formyl-6-methoxyphenoxy)acetic acid, 95%, 2-(4-Bromo-2-formyl-6-methoxyphenoxy)acetic acid, 2-(4-Bromo-2-formyl-6-methoxyphenoxy)acetic acid 97%, 2-(4-Bromo-2-formyl-6-methoxyphenoxy)acetic acid, 97%, 97%, (4-bromo-2-formyl-6-methoxyphenoxy)acetic acid, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 0,5g, 50mg, 100mg, 1g, 500mg, 5g.
2-(4-bromo-2-formyl-6-methoxyphenoxy)acetic acid (CAS 20037-38-1) is a chemical compound with the molecular formula C10H9BrO5 and a molecular weight of 289.08 g/mol. IUPAC name: 2-(4-bromo-2-formyl-6-methoxyphenoxy)acetic acid. InChIKey: RCDYCPFAYHFSLV-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO5 |
|---|---|
| Molecular weight | 289.08 g/mol |
| IUPAC name | 2-(4-bromo-2-formyl-6-methoxyphenoxy)acetic acid |
| InChIKey | RCDYCPFAYHFSLV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OCC(=O)O)C=O)Br |
Computed by PubChem (NCBI)