CAS 2791445-42-4 is the registry number for Dimethyl 4-bromo-3-hydroxyphthalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 4-bromo-3-hydroxybenzene-1,2-dicarboxylate (CAS 2791445-42-4) is a chemical compound with the molecular formula C10H9BrO5 and a molecular weight of 289.08 g/mol. IUPAC name: dimethyl 4-bromo-3-hydroxybenzene-1,2-dicarboxylate. InChIKey: ZMHHRUABUDFQDI-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO5 |
|---|---|
| Molecular weight | 289.08 g/mol |
| IUPAC name | dimethyl 4-bromo-3-hydroxybenzene-1,2-dicarboxylate |
| InChIKey | ZMHHRUABUDFQDI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Br)O)C(=O)OC |
Computed by PubChem (NCBI)