CAS 81474-46-6 appears in our catalog under these names: Bifendate Impurity 3, Methyl 4–bromo–7–methoxybenzo(d)(1，3)dioxole–5–carboxylate, Methyl 4-bromo-7-methoxybenzo[d][1,3]dioxole-5-carboxylate 97%, Methyl 4-bromo-7-methoxybenzo[d][1,3]dioxole-5-carboxylate, 97%, 97%, Methyl 4-bromo-7-methoxybenzo[d][1,3]dioxole-5-carboxylate, 97%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
Methyl 4-bromo-7-methoxy-1,3-benzodioxole-5-carboxylate (CAS 81474-46-6) is a chemical compound with the molecular formula C10H9BrO5 and a molecular weight of 289.08 g/mol. IUPAC name: methyl 4-bromo-7-methoxy-1,3-benzodioxole-5-carboxylate. InChIKey: LBTTXOWOLNELBG-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO5 |
|---|---|
| Molecular weight | 289.08 g/mol |
| IUPAC name | methyl 4-bromo-7-methoxy-1,3-benzodioxole-5-carboxylate |
| InChIKey | LBTTXOWOLNELBG-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C(=C1)C(=O)OC)Br)OCO2 |
Computed by PubChem (NCBI)