CAS 2841025-12-3 is the registry number for Methyl (R)-3-methyl-2-(3-oxo-2,3-dihydroisoxazol-5-yl)butanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R)-3-methyl-2-(3-oxo-1,2-oxazol-5-yl)butanoate (CAS 2841025-12-3) is a chemical compound with the molecular formula C9H13NO4 and a molecular weight of 199.20 g/mol. IUPAC name: methyl (2R)-3-methyl-2-(3-oxo-1,2-oxazol-5-yl)butanoate. InChIKey: QGWCBGOUMCNLQU-MRVPVSSYSA-N.
| Molecular formula | C9H13NO4 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | methyl (2R)-3-methyl-2-(3-oxo-1,2-oxazol-5-yl)butanoate |
| InChIKey | QGWCBGOUMCNLQU-MRVPVSSYSA-N |
| SMILES | CC(C)[C@H](C1=CC(=O)NO1)C(=O)OC |
Computed by PubChem (NCBI)