CAS 168836-03-1 is the registry number for Tyrphostin AG1433 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(6,7-dimethylquinoxalin-2-yl)benzene-1,2-diol (CAS 168836-03-1) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: 4-(6,7-dimethylquinoxalin-2-yl)benzene-1,2-diol. InChIKey: SMKFYHOKXJUJOT-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 4-(6,7-dimethylquinoxalin-2-yl)benzene-1,2-diol |
| InChIKey | SMKFYHOKXJUJOT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC=C(N=C2C=C1C)C3=CC(=C(C=C3)O)O |
Computed by PubChem (NCBI)