CAS 168899-61-4 appears in our catalog under these names: 3–Amino–2–bromobenzoic acid, 3-Amino-2-bromobenzoic acid, 3-Amino-2-bromobenzoic acid 97%, 3-Amino-2-bromobenzoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g.
3-amino-2-bromobenzoic acid (CAS 168899-61-4) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 3-amino-2-bromobenzoic acid. InChIKey: PAGROCHVTXMVTP-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 3-amino-2-bromobenzoic acid |
| InChIKey | PAGROCHVTXMVTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)Br)C(=O)O |
Computed by PubChem (NCBI)