Products 169036-52-6
CAS 169036-52-6 is the registry number for 1-(3,4-Dichlorophenyl)-1H-pyrrole-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-(3,4-dichlorophenyl)pyrrole-2-carbaldehyde (CAS 169036-52-6) is a chemical compound with the molecular formula C11H7Cl2NO and a molecular weight of 240.08 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)pyrrole-2-carbaldehyde. InChIKey: XPXSTXAGACLSFG-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO |
|---|---|
| Molecular weight | 240.08 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)pyrrole-2-carbaldehyde |
| InChIKey | XPXSTXAGACLSFG-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=C1)C=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)