CAS 1690585-32-0 is the registry number for 2,4,5,8-Tetrachloroquinazoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4,5,8-tetrachloroquinazoline (CAS 1690585-32-0) is a chemical compound with the molecular formula C8H2Cl4N2 and a molecular weight of 267.9 g/mol. IUPAC name: 2,4,5,8-tetrachloroquinazoline. InChIKey: RUOLLEPXRYOQAM-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl4N2 |
|---|---|
| Molecular weight | 267.9 g/mol |
| IUPAC name | 2,4,5,8-tetrachloroquinazoline |
| InChIKey | RUOLLEPXRYOQAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)C(=NC(=N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)