CAS 27224-97-1 appears in our catalog under these names: 1,3,6,8-Tetrachloro-2,7-naphthyridine 97%, 1,3,6,8–Tetrachloro–2,7–naphthyridine. Offered by: Ambeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg.
1,3,6,8-tetrachloro-2,7-naphthyridine (CAS 27224-97-1) is a chemical compound with the molecular formula C8H2Cl4N2 and a molecular weight of 267.9 g/mol. IUPAC name: 1,3,6,8-tetrachloro-2,7-naphthyridine. InChIKey: ZJBZAKMLSOJQEB-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl4N2 |
|---|---|
| Molecular weight | 267.9 g/mol |
| IUPAC name | 1,3,6,8-tetrachloro-2,7-naphthyridine |
| InChIKey | ZJBZAKMLSOJQEB-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(N=C(C2=C(N=C1Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)