CAS 25983-14-6 appears in our catalog under these names: 2,3,6,7–Tetrachloroquinoxaline, 2,3,6,7-Tetrachloroquinoxaline 98%, 2,3,6,7-Tetrachloroquinoxaline, 98%, 98%, 2,3,6,7-Tetrachloroquinoxaline, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
2,3,6,7-tetrachloroquinoxaline (CAS 25983-14-6) is a chemical compound with the molecular formula C8H2Cl4N2 and a molecular weight of 267.9 g/mol. IUPAC name: 2,3,6,7-tetrachloroquinoxaline. InChIKey: GQWLQHHUPKCOJH-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl4N2 |
|---|---|
| Molecular weight | 267.9 g/mol |
| IUPAC name | 2,3,6,7-tetrachloroquinoxaline |
| InChIKey | GQWLQHHUPKCOJH-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)