Products 54185-42-1
CAS 54185-42-1 is the registry number for 2,4,6,8-Tetrachloroquinazoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,4,6,8-tetrachloroquinazoline (CAS 54185-42-1) is a chemical compound with the molecular formula C8H2Cl4N2 and a molecular weight of 267.9 g/mol. IUPAC name: 2,4,6,8-tetrachloroquinazoline. InChIKey: GYUFSVVBAINEBI-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl4N2 |
|---|---|
| Molecular weight | 267.9 g/mol |
| IUPAC name | 2,4,6,8-tetrachloroquinazoline |
| InChIKey | GYUFSVVBAINEBI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=NC(=N2)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Quinazoline, 2,4,6,8-tetrachloro-