Products 16908-91-1
CAS 16908-91-1 appears in our catalog under these names: L-Isoidide Mononitrate (Diluted with Lactose), Isosorbide Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
[(3S,3aR,6S,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate (CAS 16908-91-1) is a chemical compound with the molecular formula C6H9NO6 and a molecular weight of 191.14 g/mol. IUPAC name: [(3S,3aR,6S,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate. InChIKey: YWXYYJSYQOXTPL-UNTFVMJOSA-N.
| Molecular formula | C6H9NO6 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | [(3S,3aR,6S,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
| InChIKey | YWXYYJSYQOXTPL-UNTFVMJOSA-N |
| SMILES | C1[C@@H]([C@@H]2[C@H](O1)[C@H](CO2)O[N+](=O)[O-])O |
Computed by PubChem (NCBI)