CAS 64153-47-5 appears in our catalog under these names: (R)-3-Aminopropane-1,1,3-tricarboxylic acid, 95%, H-gamma-Carboxy-D-Glu-OH. Offered by: Chemat Brand, Creative Peptides. Available pack sizes: on request, 10mg, 50mg, 250mg.
(3R)-3-aminopropane-1,1,3-tricarboxylic acid (CAS 64153-47-5) is a chemical compound with the molecular formula C6H9NO6 and a molecular weight of 191.14 g/mol. IUPAC name: (3R)-3-aminopropane-1,1,3-tricarboxylic acid. InChIKey: UHBYWPGGCSDKFX-GSVOUGTGSA-N.
| Molecular formula | C6H9NO6 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | (3R)-3-aminopropane-1,1,3-tricarboxylic acid |
| InChIKey | UHBYWPGGCSDKFX-GSVOUGTGSA-N |
| SMILES | C([C@H](C(=O)O)N)C(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)