Products 35993-37-4

CAS 35993-37-4 is the registry number for Isosorbide Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(3R,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate (CAS 35993-37-4) is a chemical compound with the molecular formula C6H9NO6 and a molecular weight of 191.14 g/mol. IUPAC name: [(3R,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate. InChIKey: YWXYYJSYQOXTPL-KVTDHHQDSA-N.

Identity
Molecular formulaC6H9NO6
Molecular weight191.14 g/mol
IUPAC name[(3R,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate
InChIKeyYWXYYJSYQOXTPL-KVTDHHQDSA-N
SMILESC1[C@H]([C@@H]2[C@H](O1)[C@@H](CO2)O[N+](=O)[O-])O

Computed by PubChem (NCBI)