Products 807630-34-8
CAS 807630-34-8 appears in our catalog under these names: Nitrilotriacetic Acid-d9, >95% (HPLC), Nitrilotriacetic Acid-d9, 98 atom % D, min 98% Chemical Purity, Nitrilotriacetic acid-d9. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5mg, 0,25g, 0,1g, 25 mg, 10 mg, 50 mg.
Deuterio 2-[bis(1,1-dideuterio-2-deuteriooxy-2-oxoethyl)amino]-2,2-dideuterioacetate (CAS 807630-34-8) is a chemical compound with the molecular formula C6H9NO6 and a molecular weight of 200.19 g/mol. IUPAC name: deuterio 2-[bis(1,1-dideuterio-2-deuteriooxy-2-oxoethyl)amino]-2,2-dideuterioacetate. InChIKey: MGFYIUFZLHCRTH-HCHPEDFLSA-N.
| Molecular formula | C6H9NO6 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | deuterio 2-[bis(1,1-dideuterio-2-deuteriooxy-2-oxoethyl)amino]-2,2-dideuterioacetate |
| InChIKey | MGFYIUFZLHCRTH-HCHPEDFLSA-N |
| SMILES | [2H]C([2H])(C(=O)O[2H])N(C([2H])([2H])C(=O)O[2H])C([2H])([2H])C(=O)O[2H] |
Computed by PubChem (NCBI)