Products 1691167-15-3
CAS 1691167-15-3 is the registry number for 1-(5-Fluoro-1-phenyl-1H-pyrazol-4-yl)ethan-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(5-fluoro-1-phenylpyrazol-4-yl)ethanol (CAS 1691167-15-3) is a chemical compound with the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. IUPAC name: 1-(5-fluoro-1-phenylpyrazol-4-yl)ethanol. InChIKey: XDBAGCDAHQMUHN-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2O |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 1-(5-fluoro-1-phenylpyrazol-4-yl)ethanol |
| InChIKey | XDBAGCDAHQMUHN-UHFFFAOYSA-N |
| SMILES | CC(C1=C(N(N=C1)C2=CC=CC=C2)F)O |
Computed by PubChem (NCBI)