CAS 169136-33-8 is the registry number for Necrostatin-21. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole (CAS 169136-33-8) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: 1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole. InChIKey: WQSHEPAFFTVLAP-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole |
| InChIKey | WQSHEPAFFTVLAP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=C1C=NN3)NC4=CC=CC=C24 |
Computed by PubChem (NCBI)