Products 1691794-69-0
CAS 1691794-69-0 appears in our catalog under these names: 8-Bromo-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid, 8-Bromochroman-3-carboxylic acid, 95%, 8-bromo-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid, 95%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat. Available pack sizes: 50mg, 0,5g, 250mg, 1g, 5g, 100mg.
8-bromo-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1691794-69-0) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: 8-bromo-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: NGZDYSMQMJYANJ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 8-bromo-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | NGZDYSMQMJYANJ-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C=CC=C2Br)C(=O)O |
Computed by PubChem (NCBI)