CAS 1692332-66-3 appears in our catalog under these names: 6-Chloro-N,N-dimethyl-4-nitropyridin-2-amine, 95%, 6-Chloro-N,N-dimethyl-4-nitropyridin-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-chloro-N,N-dimethyl-4-nitropyridin-2-amine (CAS 1692332-66-3) is a chemical compound with the molecular formula C7H8ClN3O2 and a molecular weight of 201.61 g/mol. IUPAC name: 6-chloro-N,N-dimethyl-4-nitropyridin-2-amine. InChIKey: GFXFHGGMGILCEK-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O2 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 6-chloro-N,N-dimethyl-4-nitropyridin-2-amine |
| InChIKey | GFXFHGGMGILCEK-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)