CAS 16939-28-9 is the registry number for N-Mesitylbenzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,4,6-trimethylphenyl)benzenesulfonamide (CAS 16939-28-9) is a chemical compound with the molecular formula C15H17NO2S and a molecular weight of 275.4 g/mol. IUPAC name: N-(2,4,6-trimethylphenyl)benzenesulfonamide. InChIKey: PNCQDOWVNWILKC-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2S |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | N-(2,4,6-trimethylphenyl)benzenesulfonamide |
| InChIKey | PNCQDOWVNWILKC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NS(=O)(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)