CAS 1694229-20-3 appears in our catalog under these names: tert-Butyl 7-ethynyl-2,3-dihydro-1H-indole-1-carboxylate, 95%, tert-Butyl 7-ethynyl-2,3-dihydro-1H-indole-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tert-butyl 7-ethynyl-2,3-dihydroindole-1-carboxylate (CAS 1694229-20-3) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl 7-ethynyl-2,3-dihydroindole-1-carboxylate. InChIKey: FNPPYPUZJCNJML-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl 7-ethynyl-2,3-dihydroindole-1-carboxylate |
| InChIKey | FNPPYPUZJCNJML-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C(=CC=C2)C#C |
Computed by PubChem (NCBI)