CAS 16947-07-2 appears in our catalog under these names: Boc-glu(ome)-onp, 98%, Boc-Glu(OMe)-ONp, 97%, Boc–Glu(OMe)–ONp. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 25g, 5g.
5-O-methyl 1-O-(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (CAS 16947-07-2) is a chemical compound with the molecular formula C17H22N2O8 and a molecular weight of 382.4 g/mol. IUPAC name: 5-O-methyl 1-O-(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate. InChIKey: NBDDNYQRWHNTOO-ZDUSSCGKSA-N.
| Molecular formula | C17H22N2O8 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | 5-O-methyl 1-O-(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| InChIKey | NBDDNYQRWHNTOO-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OC)C(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)