CAS 73384-27-7 appears in our catalog under these names: Diethyl 2-acetamido-2-(3-methoxy-4-nitrobenzyl)malonate, 98%, 2-(Acetylamino)-2-((3-methoxy-4-nitrophenyl)methyl)-propanedioic Acid 1,3-Diethyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g, 250mg, 500mg.
Diethyl 2-acetamido-2-[(3-methoxy-4-nitrophenyl)methyl]propanedioate (CAS 73384-27-7) is a chemical compound with the molecular formula C17H22N2O8 and a molecular weight of 382.4 g/mol. IUPAC name: diethyl 2-acetamido-2-[(3-methoxy-4-nitrophenyl)methyl]propanedioate. InChIKey: HVHHQUCZVAIMNI-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O8 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | diethyl 2-acetamido-2-[(3-methoxy-4-nitrophenyl)methyl]propanedioate |
| InChIKey | HVHHQUCZVAIMNI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1=CC(=C(C=C1)[N+](=O)[O-])OC)(C(=O)OCC)NC(=O)C |
Computed by PubChem (NCBI)