Products 62268-19-3
CAS 62268-19-3 is the registry number for (S)-Aminoglutethimide tartrate. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
(3S)-3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione;(2R,3R)-2,3-dihydroxybutanedioic acid (CAS 62268-19-3) is a chemical compound with the molecular formula C17H22N2O8 and a molecular weight of 382.4 g/mol. IUPAC name: (3S)-3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione;(2R,3R)-2,3-dihydroxybutanedioic acid. InChIKey: DQUXPVVSVXIQNE-TZXXFBNGSA-N.
| Molecular formula | C17H22N2O8 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | (3S)-3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione;(2R,3R)-2,3-dihydroxybutanedioic acid |
| InChIKey | DQUXPVVSVXIQNE-TZXXFBNGSA-N |
| SMILES | CC[C@]1(CCC(=O)NC1=O)C2=CC=C(C=C2)N.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)