Products 57288-04-7
CAS 57288-04-7 is the registry number for S-(-)-Aminoglutethimide (D-tartrate). Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R)-3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione;2,3-dihydroxybutanedioic acid (CAS 57288-04-7) is a chemical compound with the molecular formula C17H22N2O8 and a molecular weight of 382.4 g/mol. IUPAC name: (3R)-3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione;2,3-dihydroxybutanedioic acid. InChIKey: DQUXPVVSVXIQNE-BTQNPOSSSA-N.
| Molecular formula | C17H22N2O8 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | (3R)-3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione;2,3-dihydroxybutanedioic acid |
| InChIKey | DQUXPVVSVXIQNE-BTQNPOSSSA-N |
| SMILES | CC[C@@]1(CCC(=O)NC1=O)C2=CC=C(C=C2)N.C(C(C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)