CAS 50737-31-0 appears in our catalog under these names: 5-(Chloromethyl)-3-(3-methylphenyl)-1,2,4-oxadiazole, 95%, 5-(Chloromethyl)-3-(m-tolyl)-1,2,4-oxadiazole, 95%, 5-(Chloromethyl)-3-(3-methylphenyl)-1,2,4-oxadiazole, 5-(Chloromethyl)-3-(m-tolyl)-1,2,4-oxadiazole, 95%, 95%, 5-Chloromethyl-3-m-tolyl-[1,2,4]oxadiazole, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g, 2,5g, 50g.
5-(chloromethyl)-3-(3-methylphenyl)-1,2,4-oxadiazole (CAS 50737-31-0) is a chemical compound with the molecular formula C10H9ClN2O and a molecular weight of 208.64 g/mol. IUPAC name: 5-(chloromethyl)-3-(3-methylphenyl)-1,2,4-oxadiazole. InChIKey: MWQGYNOPINNJNN-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(3-methylphenyl)-1,2,4-oxadiazole |
| InChIKey | MWQGYNOPINNJNN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)