Products 1695390-29-4
CAS 1695390-29-4 is the registry number for 3-(3-bromo-2,6-difluorophenyl)pentan-3-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(3-bromo-2,6-difluorophenyl)pentan-3-ol (CAS 1695390-29-4) is a chemical compound with the molecular formula C11H13BrF2O and a molecular weight of 279.12 g/mol. IUPAC name: 3-(3-bromo-2,6-difluorophenyl)pentan-3-ol. InChIKey: UDGSWBUIMMXJNF-UHFFFAOYSA-N.
| Molecular formula | C11H13BrF2O |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | 3-(3-bromo-2,6-difluorophenyl)pentan-3-ol |
| InChIKey | UDGSWBUIMMXJNF-UHFFFAOYSA-N |
| SMILES | CCC(CC)(C1=C(C=CC(=C1F)Br)F)O |
Computed by PubChem (NCBI)