CAS 2008390-16-5 is the registry number for 2-Bromo-α-(1,1-dimethylethyl)-3,6-difluorobenzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(2-bromo-3,6-difluorophenyl)-2,2-dimethylpropan-1-ol (CAS 2008390-16-5) is a chemical compound with the molecular formula C11H13BrF2O and a molecular weight of 279.12 g/mol. IUPAC name: 1-(2-bromo-3,6-difluorophenyl)-2,2-dimethylpropan-1-ol. InChIKey: JQXSBOFYJSJVKQ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrF2O |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | 1-(2-bromo-3,6-difluorophenyl)-2,2-dimethylpropan-1-ol |
| InChIKey | JQXSBOFYJSJVKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=C(C=CC(=C1Br)F)F)O |
Computed by PubChem (NCBI)