CAS 2734775-63-2 is the registry number for 2-Bromo-4-(tert-butyl)-1-(difluoromethoxy)benzene, ≥98.1%, ≥98.1%. Offered by: Chemat. Available pack sizes: 1g.
2-bromo-4-tert-butyl-1-(difluoromethoxy)benzene (CAS 2734775-63-2) is a chemical compound with the molecular formula C11H13BrF2O and a molecular weight of 279.12 g/mol. IUPAC name: 2-bromo-4-tert-butyl-1-(difluoromethoxy)benzene. InChIKey: UHOFHOHABPMJMW-UHFFFAOYSA-N.
| Molecular formula | C11H13BrF2O |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | 2-bromo-4-tert-butyl-1-(difluoromethoxy)benzene |
| InChIKey | UHOFHOHABPMJMW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OC(F)F)Br |
Computed by PubChem (NCBI)