Products 2764728-10-9
CAS 2764728-10-9 is the registry number for 1-Bromo-4-(tert-butyl)-2-(difluoromethoxy)benzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-4-tert-butyl-2-(difluoromethoxy)benzene (CAS 2764728-10-9) is a chemical compound with the molecular formula C11H13BrF2O and a molecular weight of 279.12 g/mol. IUPAC name: 1-bromo-4-tert-butyl-2-(difluoromethoxy)benzene. InChIKey: OEDCXOAETSJUAA-UHFFFAOYSA-N.
| Molecular formula | C11H13BrF2O |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | 1-bromo-4-tert-butyl-2-(difluoromethoxy)benzene |
| InChIKey | OEDCXOAETSJUAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)Br)OC(F)F |
Computed by PubChem (NCBI)