Products 1696402-27-3
CAS 1696402-27-3 is the registry number for (S)-Ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate. Offered by: TRC. Available pack sizes: 5g.
Ethyl 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate (CAS 1696402-27-3) is a chemical compound with the molecular formula C9H14O5 and a molecular weight of 202.20 g/mol. IUPAC name: ethyl 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate. InChIKey: AVOWRQFMZHDBMI-LURJTMIESA-N.
| Molecular formula | C9H14O5 |
|---|---|
| Molecular weight | 202.20 g/mol |
| IUPAC name | ethyl 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate |
| InChIKey | AVOWRQFMZHDBMI-LURJTMIESA-N |
| SMILES | CCOC(=O)C[C@H]1C(=O)OC(O1)(C)C |
Computed by PubChem (NCBI)