CAS 169675-08-5 appears in our catalog under these names: Ro60–0175, Ro60-0175, 98%, Ro60-0175/ 97.09% (existing batch purity), Ro60-0175, 99.52%, (S)-1-(6-Chloro-5-fluoro-1H-indol-1-yl)propan-2-amine, 98%. Offered by: GLPBio, AmBeed, TargetMol, MedChemExpress, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 50 mg, 5 mg.
(2S)-1-(6-chloro-5-fluoroindol-1-yl)propan-2-amine (CAS 169675-08-5) is a chemical compound with the molecular formula C11H12ClFN2 and a molecular weight of 226.68 g/mol. IUPAC name: (2S)-1-(6-chloro-5-fluoroindol-1-yl)propan-2-amine. InChIKey: XJJZQXUGLLXTHO-ZETCQYMHSA-N.
| Molecular formula | C11H12ClFN2 |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | (2S)-1-(6-chloro-5-fluoroindol-1-yl)propan-2-amine |
| InChIKey | XJJZQXUGLLXTHO-ZETCQYMHSA-N |
| SMILES | C[C@@H](CN1C=CC2=CC(=C(C=C21)Cl)F)N |
Computed by PubChem (NCBI)