CAS 2768138-79-8 is the registry number for 6-Chloro-4-fluoro-2-methyl-1-(1-methylethyl)-1H-benzimidazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-chloro-4-fluoro-2-methyl-1-propan-2-ylbenzimidazole (CAS 2768138-79-8) is a chemical compound with the molecular formula C11H12ClFN2 and a molecular weight of 226.68 g/mol. IUPAC name: 6-chloro-4-fluoro-2-methyl-1-propan-2-ylbenzimidazole. InChIKey: CKZGZWLHTOHQSE-UHFFFAOYSA-N.
| Molecular formula | C11H12ClFN2 |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | 6-chloro-4-fluoro-2-methyl-1-propan-2-ylbenzimidazole |
| InChIKey | CKZGZWLHTOHQSE-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C(C)C)C=C(C=C2F)Cl |
Computed by PubChem (NCBI)