CAS 41266-63-1 appears in our catalog under these names: 8-Fluoro-1h,2h,3h,4h,5h-pyrido[4,3-b]indole hydrochloride, 95%, 8-Fluoro-2,3,4,5-tetrahydro-1H-pyrido(4,3-b)indole hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
8-fluoro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride (CAS 41266-63-1) is a chemical compound with the molecular formula C11H12ClFN2 and a molecular weight of 226.68 g/mol. IUPAC name: 8-fluoro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride. InChIKey: CWLSVHQHFSKNIA-UHFFFAOYSA-N.
| Molecular formula | C11H12ClFN2 |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | 8-fluoro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride |
| InChIKey | CWLSVHQHFSKNIA-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1NC3=C2C=C(C=C3)F.Cl |
Computed by PubChem (NCBI)