CAS 24335-14-6 is the registry number for 6-Fluoro-1H,2H,3H,4H,9H-pyrido(3,4-b)indole hydrochloride. Offered by: Biosynth. Available pack sizes: 0,1g, 0,5g, 0,25g, 1g.
6-fluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (CAS 24335-14-6) is a chemical compound with the molecular formula C11H12ClFN2 and a molecular weight of 226.68 g/mol. IUPAC name: 6-fluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride. InChIKey: HSNPVBHGOKGOEF-UHFFFAOYSA-N.
| Molecular formula | C11H12ClFN2 |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | 6-fluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| InChIKey | HSNPVBHGOKGOEF-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C3=C(N2)C=CC(=C3)F.Cl |
Computed by PubChem (NCBI)