CAS 16968-19-7 appears in our catalog under these names: Carbamazepine Impurity 7, 2,2'-Dinitrodibenzyl, >95% (HPLC), 2,2'–Dinitrodibenzyl, 2,2'-Dinitrodibenzyl, >98.0%(GC), 1,2-Bis(2-nitrophenyl)ethane 97%. Offered by: Chemat Brand, TRC, GLPBio, TCI, Ambeed. Available pack sizes: on request, 1g, 25g, 500mg, 100g, 500g, 5g, 10g.
1-nitro-2-[2-(2-nitrophenyl)ethyl]benzene (CAS 16968-19-7) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 1-nitro-2-[2-(2-nitrophenyl)ethyl]benzene. InChIKey: YBOZRPPSBVIHGJ-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 1-nitro-2-[2-(2-nitrophenyl)ethyl]benzene |
| InChIKey | YBOZRPPSBVIHGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCC2=CC=CC=C2[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)