Products 169772-26-3
CAS 169772-26-3 is the registry number for 2-[[2,6-di(propan-2-yl)phenyl]amino]-2-oxoacetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.
2-[2,6-di(propan-2-yl)anilino]-2-oxoacetic acid (CAS 169772-26-3) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: 2-[2,6-di(propan-2-yl)anilino]-2-oxoacetic acid. InChIKey: YVTXGNXUMNTBDW-UHFFFAOYSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | 2-[2,6-di(propan-2-yl)anilino]-2-oxoacetic acid |
| InChIKey | YVTXGNXUMNTBDW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)NC(=O)C(=O)O |
Computed by PubChem (NCBI)