CAS 1697929-45-5 appears in our catalog under these names: 7-Methyl-1h-spiro[indole-3,4'-oxane]-2-one, 95%, 7-Methyl-2',3',5',6'-tetrahydrospiro(indoline-3,4'-pyran)-2-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
7-methylspiro[1H-indole-3,4'-oxane]-2-one (CAS 1697929-45-5) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 7-methylspiro[1H-indole-3,4'-oxane]-2-one. InChIKey: SXROIVWYRXMJCA-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 7-methylspiro[1H-indole-3,4'-oxane]-2-one |
| InChIKey | SXROIVWYRXMJCA-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C3(CCOCC3)C(=O)N2 |
Computed by PubChem (NCBI)