Products 1698417-10-5
CAS 1698417-10-5 is the registry number for {[(tert-Butoxy)carbonyl]amino}(4-isopropoxyphenyl)acetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-propan-2-yloxyphenyl)acetic acid (CAS 1698417-10-5) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-propan-2-yloxyphenyl)acetic acid. InChIKey: HHLRSIRFPJAVAT-UHFFFAOYSA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-propan-2-yloxyphenyl)acetic acid |
| InChIKey | HHLRSIRFPJAVAT-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)