CAS 182748-72-7 appears in our catalog under these names: Boc-D-Asp(OBzl)-ol, 95%, Boc–D–aspartinol 4–Benzyl Ester, Boc-D-aspartinol 4-Benzyl Ester 98%, Boc-D-aspartinol 4-Benzyl Ester, 98%, 98%, Benzyl (R)-3-((tert-butoxycarbonyl)amino)-4-hydroxybutanoate, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg, 50g.
Benzyl (3R)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 182748-72-7) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: benzyl (3R)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: XEGSFNZVTUGZCK-CYBMUJFWSA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | benzyl (3R)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | XEGSFNZVTUGZCK-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)OCC1=CC=CC=C1)CO |
Computed by PubChem (NCBI)