Products 2570172-37-9
CAS 2570172-37-9 is the registry number for Methyl (2R)-2-{[(tert-butoxy)carbonyl]amino}-2-(4-ethoxyphenyl)acetate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (2R)-2-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (CAS 2570172-37-9) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: methyl (2R)-2-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate. InChIKey: BSQTVRUXNKSWIG-CYBMUJFWSA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | methyl (2R)-2-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| InChIKey | BSQTVRUXNKSWIG-CYBMUJFWSA-N |
| SMILES | CCOC1=CC=C(C=C1)[C@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)